C15H18N2O — CID 82477778
4-(1,3,3-trimethyl-2-oxoindol-5-yl)butanenitrile (PubChem CID 82477778) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-(1,3,3-trimethyl-2-oxoindol-5-yl)butanenitrile.
| Compound Name | 4-(1,3,3-trimethyl-2-oxoindol-5-yl)butanenitrile |
|---|---|
| PubChem CID | 82477778 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-(1,3,3-trimethyl-2-oxoindol-5-yl)butanenitrile |
| SMILES | CN1C(=O)C(C)(C)c2cc(CCCC#N)ccc21 |
| InChI | InChI=1S/C15H18N2O/c1-15(2)12-10-11(6-4-5-9-16)7-8-13(12)17(3)14(15)18/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | WRYATOCRBPRVDT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|