C10H11ClN4S — CID 82482135
5-(3-amino-4-chlorophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 82482135) has the molecular formula C10H11ClN4S and a molecular weight of 254.75 g/mol. Its IUPAC name is 5-(3-amino-4-chlorophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-amino-4-chlorophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 82482135 |
| Molecular Formula | C10H11ClN4S |
| Molecular Weight | 254.75 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-(3-amino-4-chlorophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(-c2ccc(Cl)c(N)c2)s1 |
| InChI | InChI=1S/C10H11ClN4S/c1-15(2)10-14-13-9(16-10)6-3-4-7(11)8(12)5-6/h3-5H,12H2,1-2H3 |
| InChIKey | LGOGNLVJBPSSNI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.75 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|