C15H17N3O — CID 82482255
2-[2-(1,2-dimethylindol-3-yl)-1,3-oxazol-4-yl]ethanamine (PubChem CID 82482255) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[2-(1,2-dimethylindol-3-yl)-1,3-oxazol-4-yl]ethanamine.
| Compound Name | 2-[2-(1,2-dimethylindol-3-yl)-1,3-oxazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 82482255 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-[2-(1,2-dimethylindol-3-yl)-1,3-oxazol-4-yl]ethanamine |
| SMILES | Cc1c(-c2nc(CCN)co2)c2ccccc2n1C |
| InChI | InChI=1S/C15H17N3O/c1-10-14(15-17-11(7-8-16)9-19-15)12-5-3-4-6-13(12)18(10)2/h3-6,9H,7-8,16H2,1-2H3 |
| InChIKey | OLEUPTBYGCDZPP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |