C12H16N2O3S — CID 82487620
N-(2-hydroxyethyl)-N,1-dimethylindole-3-sulfonamide (PubChem CID 82487620) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N,1-dimethylindole-3-sulfonamide.
| Compound Name | N-(2-hydroxyethyl)-N,1-dimethylindole-3-sulfonamide |
|---|---|
| PubChem CID | 82487620 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-(2-hydroxyethyl)-N,1-dimethylindole-3-sulfonamide |
| SMILES | CN(CCO)S(=O)(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C12H16N2O3S/c1-13-9-12(10-5-3-4-6-11(10)13)18(16,17)14(2)7-8-15/h3-6,9,15H,7-8H2,1-2H3 |
| InChIKey | CBNXWUDHZHCQAK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |