C10H10BrNS2 — CID 82489691
[4-(5-bromothiophen-2-yl)-5-methylthiophen-3-yl]methanamine (PubChem CID 82489691) has the molecular formula C10H10BrNS2 and a molecular weight of 288.24 g/mol. Its IUPAC name is [4-(5-bromothiophen-2-yl)-5-methylthiophen-3-yl]methanamine.
| Compound Name | [4-(5-bromothiophen-2-yl)-5-methylthiophen-3-yl]methanamine |
|---|---|
| PubChem CID | 82489691 |
| Molecular Formula | C10H10BrNS2 |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | [4-(5-bromothiophen-2-yl)-5-methylthiophen-3-yl]methanamine |
| SMILES | Cc1scc(CN)c1-c1ccc(Br)s1 |
| InChI | InChI=1S/C10H10BrNS2/c1-6-10(7(4-12)5-13-6)8-2-3-9(11)14-8/h2-3,5H,4,12H2,1H3 |
| InChIKey | WXRDPZQNENSSOE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |