C28H18Br2N8S6 — CID 157485731
4,7-bis(5-bromothiophen-2-yl)-2,1,3-benzothiadiazole-5,6-diamine;4,7-dithiophen-2-yl-2,1,3-benzothiadiazole-5,6-diamine (PubChem CID 157485731) has the molecular formula C28H18Br2N8S6 and a molecular weight of 818.72 g/mol. Its IUPAC name is 4,7-bis(5-bromothiophen-2-yl)-2,1,3-benzothiadiazole-5,6-diamine;4,7-dithiophen-2-yl-2,1,3-benzothiadiazole-5,6-diamine.
| Compound Name | 4,7-bis(5-bromothiophen-2-yl)-2,1,3-benzothiadiazole-5,6-diamine;4,7-dithiophen-2-yl-2,1,3-benzothiadiazole-5,6-diamine |
|---|---|
| PubChem CID | 157485731 |
| Molecular Formula | C28H18Br2N8S6 |
| Molecular Weight | 818.72 g/mol |
| Exact Mass | 815.83 |
| IUPAC Name | 4,7-bis(5-bromothiophen-2-yl)-2,1,3-benzothiadiazole-5,6-diamine;4,7-dithiophen-2-yl-2,1,3-benzothiadiazole-5,6-diamine |
| SMILES | Nc1c(N)c(-c2ccc(Br)s2)c2nsnc2c1-c1ccc(Br)s1.Nc1c(N)c(-c2cccs2)c2nsnc2c1-c1cccs1 |
| InChI | InChI=1S/C14H8Br2N4S3.C14H10N4S3/c15-7-3-1-5(21-7)9-11(17)12(18)10(6-2-4-8(16)22-6)14-13(9)19-23-20-14;15-11-9(7-3-1-5-19-7)13-14(18-21-17-13)10(12(11)16)8-4-2-6-20-8/h1-4H,17-18H2;1-6H,15-16H2 |
| InChIKey | BWRRBJVGPCWJCW-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.72 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|