C13H14N2O3 — CID 82498068
1-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)-2-(ethylamino)ethanone (PubChem CID 82498068) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)-2-(ethylamino)ethanone.
| Compound Name | 1-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)-2-(ethylamino)ethanone |
|---|---|
| PubChem CID | 82498068 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-(5H-[1,3]dioxolo[4,5-f]indol-7-yl)-2-(ethylamino)ethanone |
| SMILES | CCNCC(=O)c1c[nH]c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C13H14N2O3/c1-2-14-6-11(16)9-5-15-10-4-13-12(3-8(9)10)17-7-18-13/h3-5,14-15H,2,6-7H2,1H3 |
| InChIKey | VZQOPJLCDSZJLY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |