C10H15N3O3 — CID 82509744
N-(3-hydroxy-1-oxo-1-piperazin-1-ylpropan-2-yl)prop-2-ynamide (PubChem CID 82509744) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is N-(3-hydroxy-1-oxo-1-piperazin-1-ylpropan-2-yl)prop-2-ynamide.
| Compound Name | N-(3-hydroxy-1-oxo-1-piperazin-1-ylpropan-2-yl)prop-2-ynamide |
|---|---|
| PubChem CID | 82509744 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | N-(3-hydroxy-1-oxo-1-piperazin-1-ylpropan-2-yl)prop-2-ynamide |
| SMILES | C#CC(=O)NC(CO)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H15N3O3/c1-2-9(15)12-8(7-14)10(16)13-5-3-11-4-6-13/h1,8,11,14H,3-7H2,(H,12,15) |
| InChIKey | ALAFVRCLNSXYGR-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|