C9H18N4O3 — CID 82510100
1-(3-hydroxy-1-oxo-1-piperazin-1-ylpropan-2-yl)-3-methylurea (PubChem CID 82510100) has the molecular formula C9H18N4O3 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-(3-hydroxy-1-oxo-1-piperazin-1-ylpropan-2-yl)-3-methylurea.
| Compound Name | 1-(3-hydroxy-1-oxo-1-piperazin-1-ylpropan-2-yl)-3-methylurea |
|---|---|
| PubChem CID | 82510100 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-(3-hydroxy-1-oxo-1-piperazin-1-ylpropan-2-yl)-3-methylurea |
| SMILES | CNC(=O)NC(CO)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C9H18N4O3/c1-10-9(16)12-7(6-14)8(15)13-4-2-11-3-5-13/h7,11,14H,2-6H2,1H3,(H2,10,12,16) |
| InChIKey | YHJIJQGPVSIPMV-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |