C11H22N4O2 — CID 82511592
1,3-dimethyl-1-(1-oxo-1-piperazin-1-ylbutan-2-yl)urea (PubChem CID 82511592) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1,3-dimethyl-1-(1-oxo-1-piperazin-1-ylbutan-2-yl)urea.
| Compound Name | 1,3-dimethyl-1-(1-oxo-1-piperazin-1-ylbutan-2-yl)urea |
|---|---|
| PubChem CID | 82511592 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1,3-dimethyl-1-(1-oxo-1-piperazin-1-ylbutan-2-yl)urea |
| SMILES | CCC(C(=O)N1CCNCC1)N(C)C(=O)NC |
| InChI | InChI=1S/C11H22N4O2/c1-4-9(14(3)11(17)12-2)10(16)15-7-5-13-6-8-15/h9,13H,4-8H2,1-3H3,(H,12,17) |
| InChIKey | ZAMOMRLKARTZBE-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |