C10H20N4O2 — CID 82510029
1-methyl-3-(1-oxo-1-piperazin-1-ylbutan-2-yl)urea (PubChem CID 82510029) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 1-methyl-3-(1-oxo-1-piperazin-1-ylbutan-2-yl)urea.
| Compound Name | 1-methyl-3-(1-oxo-1-piperazin-1-ylbutan-2-yl)urea |
|---|---|
| PubChem CID | 82510029 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1-methyl-3-(1-oxo-1-piperazin-1-ylbutan-2-yl)urea |
| SMILES | CCC(NC(=O)NC)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H20N4O2/c1-3-8(13-10(16)11-2)9(15)14-6-4-12-5-7-14/h8,12H,3-7H2,1-2H3,(H2,11,13,16) |
| InChIKey | ZBUSFYVGKAYJER-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |