C13H15N3 — CID 82512522
5-(2,4-dimethylimidazol-1-yl)-2,3-dihydro-1H-indole (PubChem CID 82512522) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-(2,4-dimethylimidazol-1-yl)-2,3-dihydro-1H-indole.
| Compound Name | 5-(2,4-dimethylimidazol-1-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 82512522 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 5-(2,4-dimethylimidazol-1-yl)-2,3-dihydro-1H-indole |
| SMILES | Cc1cn(-c2ccc3c(c2)CCN3)c(C)n1 |
| InChI | InChI=1S/C13H15N3/c1-9-8-16(10(2)15-9)12-3-4-13-11(7-12)5-6-14-13/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | WZXBQVKZADCRBE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |