C13H15BrN2O — CID 82514607
3-(3-bromo-2,5-dimethylpyrrol-1-yl)-4-methoxyaniline (PubChem CID 82514607) has the molecular formula C13H15BrN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is 3-(3-bromo-2,5-dimethylpyrrol-1-yl)-4-methoxyaniline.
| Compound Name | 3-(3-bromo-2,5-dimethylpyrrol-1-yl)-4-methoxyaniline |
|---|---|
| PubChem CID | 82514607 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-(3-bromo-2,5-dimethylpyrrol-1-yl)-4-methoxyaniline |
| SMILES | COc1ccc(N)cc1-n1c(C)cc(Br)c1C |
| InChI | InChI=1S/C13H15BrN2O/c1-8-6-11(14)9(2)16(8)12-7-10(15)4-5-13(12)17-3/h4-7H,15H2,1-3H3 |
| InChIKey | JEHORAKYBOIJJS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|