C18H19ClN3O2+ — CID 825221
3-benzyl-7-chloro-2-hydroxy-1-(2-methylpropyl)pyrimido[1,2-b]pyridazin-1-ium-4-one (PubChem CID 825221) has the molecular formula C18H19ClN3O2+ and a molecular weight of 344.82 g/mol. Its IUPAC name is 3-benzyl-7-chloro-2-hydroxy-1-(2-methylpropyl)pyrimido[1,2-b]pyridazin-1-ium-4-one.
| Compound Name | 3-benzyl-7-chloro-2-hydroxy-1-(2-methylpropyl)pyrimido[1,2-b]pyridazin-1-ium-4-one |
|---|---|
| PubChem CID | 825221 |
| Molecular Formula | C18H19ClN3O2+ |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3-benzyl-7-chloro-2-hydroxy-1-(2-methylpropyl)pyrimido[1,2-b]pyridazin-1-ium-4-one |
| SMILES | CC(C)C[n+]1c(O)c(Cc2ccccc2)c(=O)n2nc(Cl)ccc21 |
| InChI | InChI=1S/C18H18ClN3O2/c1-12(2)11-21-16-9-8-15(19)20-22(16)18(24)14(17(21)23)10-13-6-4-3-5-7-13/h3-9,12H,10-11H2,1-2H3/p+1 |
| InChIKey | DKFVMXCRNZWNAR-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|