C19H13ClN3O2+ — CID 110273215
7-chloro-2-hydroxy-1,3-diphenylpyrimido[1,2-b]pyridazin-1-ium-4-one (PubChem CID 110273215) has the molecular formula C19H13ClN3O2+ and a molecular weight of 350.79 g/mol. Its IUPAC name is 7-chloro-2-hydroxy-1,3-diphenylpyrimido[1,2-b]pyridazin-1-ium-4-one.
| Compound Name | 7-chloro-2-hydroxy-1,3-diphenylpyrimido[1,2-b]pyridazin-1-ium-4-one |
|---|---|
| PubChem CID | 110273215 |
| Molecular Formula | C19H13ClN3O2+ |
| Molecular Weight | 350.79 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 7-chloro-2-hydroxy-1,3-diphenylpyrimido[1,2-b]pyridazin-1-ium-4-one |
| SMILES | O=c1c(-c2ccccc2)c(O)[n+](-c2ccccc2)c2ccc(Cl)nn12 |
| InChI | InChI=1S/C19H12ClN3O2/c20-15-11-12-16-22(14-9-5-2-6-10-14)18(24)17(19(25)23(16)21-15)13-7-3-1-4-8-13/h1-12H/p+1 |
| InChIKey | LUGCZXZEYKPDKI-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.79 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|