C14H15N5S — CID 82528666
5-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82528666) has the molecular formula C14H15N5S and a molecular weight of 285.38 g/mol. Its IUPAC name is 5-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82528666 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 5-[1-(4-ethylphenyl)-5-methylpyrazol-4-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CCc1ccc(-n2ncc(-c3nc(=S)[nH][nH]3)c2C)cc1 |
| InChI | InChI=1S/C14H15N5S/c1-3-10-4-6-11(7-5-10)19-9(2)12(8-15-19)13-16-14(20)18-17-13/h4-8H,3H2,1-2H3,(H2,16,17,18,20) |
| InChIKey | KWKZFCFWEVHSLK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|