C7H9NO4S — CID 82531536
2-(2,4-dioxopentan-3-ylsulfonyl)acetonitrile (PubChem CID 82531536) has the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. Its IUPAC name is 2-(2,4-dioxopentan-3-ylsulfonyl)acetonitrile.
| Compound Name | 2-(2,4-dioxopentan-3-ylsulfonyl)acetonitrile |
|---|---|
| PubChem CID | 82531536 |
| Molecular Formula | C7H9NO4S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2-(2,4-dioxopentan-3-ylsulfonyl)acetonitrile |
| SMILES | CC(=O)C(C(C)=O)S(=O)(=O)CC#N |
| InChI | InChI=1S/C7H9NO4S/c1-5(9)7(6(2)10)13(11,12)4-3-8/h7H,4H2,1-2H3 |
| InChIKey | GIYFSZYPWGFVFS-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 92.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|