C10H7FN2O2S — CID 82535823
5-fluoro-2-(1,3-thiazol-2-ylamino)benzoic acid (PubChem CID 82535823) has the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. Its IUPAC name is 5-fluoro-2-(1,3-thiazol-2-ylamino)benzoic acid.
| Compound Name | 5-fluoro-2-(1,3-thiazol-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 82535823 |
| Molecular Formula | C10H7FN2O2S |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 5-fluoro-2-(1,3-thiazol-2-ylamino)benzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1Nc1nccs1 |
| InChI | InChI=1S/C10H7FN2O2S/c11-6-1-2-8(7(5-6)9(14)15)13-10-12-3-4-16-10/h1-5H,(H,12,13)(H,14,15) |
| InChIKey | HRGCQPRSBKIFHG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |