C19H15NO — CID 82540945
7-quinolin-3-yl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 82540945) has the molecular formula C19H15NO and a molecular weight of 273.33 g/mol. Its IUPAC name is 7-quinolin-3-yl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 7-quinolin-3-yl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 82540945 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 7-quinolin-3-yl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2ccc(-c3cnc4ccccc4c3)cc21 |
| InChI | InChI=1S/C19H15NO/c21-19-7-3-5-13-8-9-14(11-17(13)19)16-10-15-4-1-2-6-18(15)20-12-16/h1-2,4,6,8-12H,3,5,7H2 |
| InChIKey | RYBJLIQJGFYYRW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |