C12H14N2OS — CID 82542124
4-[5-(1-aminoethyl)-2-methyl-1,3-thiazol-4-yl]phenol (PubChem CID 82542124) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-[5-(1-aminoethyl)-2-methyl-1,3-thiazol-4-yl]phenol.
| Compound Name | 4-[5-(1-aminoethyl)-2-methyl-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 82542124 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-[5-(1-aminoethyl)-2-methyl-1,3-thiazol-4-yl]phenol |
| SMILES | Cc1nc(-c2ccc(O)cc2)c(C(C)N)s1 |
| InChI | InChI=1S/C12H14N2OS/c1-7(13)12-11(14-8(2)16-12)9-3-5-10(15)6-4-9/h3-7,15H,13H2,1-2H3 |
| InChIKey | UYIXBBPLEIEXAJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |