C12H13NOS — CID 105474603
4-(5-propan-2-yl-1,3-thiazol-4-yl)phenol (PubChem CID 105474603) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is 4-(5-propan-2-yl-1,3-thiazol-4-yl)phenol.
| Compound Name | 4-(5-propan-2-yl-1,3-thiazol-4-yl)phenol |
|---|---|
| PubChem CID | 105474603 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 4-(5-propan-2-yl-1,3-thiazol-4-yl)phenol |
| SMILES | CC(C)c1scnc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C12H13NOS/c1-8(2)12-11(13-7-15-12)9-3-5-10(14)6-4-9/h3-8,14H,1-2H3 |
| InChIKey | MLYUQQYLGJWCOI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |