C27H24N4OS2 — CID 162640192
4-[bis[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]methyl]phenol (PubChem CID 162640192) has the molecular formula C27H24N4OS2 and a molecular weight of 484.65 g/mol. Its IUPAC name is 4-[bis[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]methyl]phenol.
| Compound Name | 4-[bis[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 162640192 |
| Molecular Formula | C27H24N4OS2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 4-[bis[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]methyl]phenol |
| SMILES | Cc1ccc(-c2nc(N)sc2C(c2ccc(O)cc2)c2sc(N)nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H24N4OS2/c1-15-3-7-18(8-4-15)22-24(33-26(28)30-22)21(17-11-13-20(32)14-12-17)25-23(31-27(29)34-25)19-9-5-16(2)6-10-19/h3-14,21,32H,1-2H3,(H2,28,30)(H2,29,31) |
| InChIKey | URXAWVZKGLGMQC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |