C17H24O4 — CID 82551889
5-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]-5-oxopentanoic acid (PubChem CID 82551889) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]-5-oxopentanoic acid.
| Compound Name | 5-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 82551889 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 5-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]-5-oxopentanoic acid |
| SMILES | Cc1cc(C)c(OCC(C)C)c(C(=O)CCCC(=O)O)c1 |
| InChI | InChI=1S/C17H24O4/c1-11(2)10-21-17-13(4)8-12(3)9-14(17)15(18)6-5-7-16(19)20/h8-9,11H,5-7,10H2,1-4H3,(H,19,20) |
| InChIKey | OHPJVCZYSKJASU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |