C16H22O4 — CID 82551893
4-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]-4-oxobutanoic acid (PubChem CID 82551893) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 4-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82551893 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 4-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]-4-oxobutanoic acid |
| SMILES | Cc1cc(C)c(OCC(C)C)c(C(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C16H22O4/c1-10(2)9-20-16-12(4)7-11(3)8-13(16)14(17)5-6-15(18)19/h7-8,10H,5-6,9H2,1-4H3,(H,18,19) |
| InChIKey | CCFGZEUDJGFOMN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |