C13H14Cl2N4 — CID 82557301
6-(2,3-dichlorophenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 82557301) has the molecular formula C13H14Cl2N4 and a molecular weight of 297.19 g/mol. Its IUPAC name is 6-(2,3-dichlorophenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-(2,3-dichlorophenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 82557301 |
| Molecular Formula | C13H14Cl2N4 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 6-(2,3-dichlorophenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CC1CC(c2cccc(Cl)c2Cl)Cn2nc(N)nc21 |
| InChI | InChI=1S/C13H14Cl2N4/c1-7-5-8(6-19-12(7)17-13(16)18-19)9-3-2-4-10(14)11(9)15/h2-4,7-8H,5-6H2,1H3,(H2,16,18) |
| InChIKey | MAZXZANVDURPEZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |