C13H16N4O — CID 82557260
3-(2-amino-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)phenol (PubChem CID 82557260) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-(2-amino-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)phenol.
| Compound Name | 3-(2-amino-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)phenol |
|---|---|
| PubChem CID | 82557260 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-(2-amino-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)phenol |
| SMILES | CC1CC(c2cccc(O)c2)Cn2nc(N)nc21 |
| InChI | InChI=1S/C13H16N4O/c1-8-5-10(9-3-2-4-11(18)6-9)7-17-12(8)15-13(14)16-17/h2-4,6,8,10,18H,5,7H2,1H3,(H2,14,16) |
| InChIKey | SGWNSBBBZGTEEX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |