C13H14F2N4 — CID 82557268
6-(3,4-difluorophenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 82557268) has the molecular formula C13H14F2N4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-(3,4-difluorophenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 82557268 |
| Molecular Formula | C13H14F2N4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 6-(3,4-difluorophenyl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CC1CC(c2ccc(F)c(F)c2)Cn2nc(N)nc21 |
| InChI | InChI=1S/C13H14F2N4/c1-7-4-9(6-19-12(7)17-13(16)18-19)8-2-3-10(14)11(15)5-8/h2-3,5,7,9H,4,6H2,1H3,(H2,16,18) |
| InChIKey | JAGADOXFGSHPFE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |