C18H31N5O — CID 82564909
4-[4-[(4-pyrazol-1-ylpiperidin-1-yl)methyl]piperidin-3-yl]morpholine (PubChem CID 82564909) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is 4-[4-[(4-pyrazol-1-ylpiperidin-1-yl)methyl]piperidin-3-yl]morpholine.
| Compound Name | 4-[4-[(4-pyrazol-1-ylpiperidin-1-yl)methyl]piperidin-3-yl]morpholine |
|---|---|
| PubChem CID | 82564909 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 4-[4-[(4-pyrazol-1-ylpiperidin-1-yl)methyl]piperidin-3-yl]morpholine |
| SMILES | c1cnn(C2CCN(CC3CCNCC3N3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C18H31N5O/c1-5-20-23(7-1)17-3-8-21(9-4-17)15-16-2-6-19-14-18(16)22-10-12-24-13-11-22/h1,5,7,16-19H,2-4,6,8-15H2 |
| InChIKey | VUJQKRICGUZXNM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |