C17H12N4O2S — CID 82565686
2-(4-aminophenyl)-5-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid (PubChem CID 82565686) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-(4-aminophenyl)-5-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid.
| Compound Name | 2-(4-aminophenyl)-5-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 82565686 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-(4-aminophenyl)-5-thiophen-2-yl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid |
| SMILES | Nc1ccc(-c2nc3c(C(=O)O)ccc(-c4cccs4)n3n2)cc1 |
| InChI | InChI=1S/C17H12N4O2S/c18-11-5-3-10(4-6-11)15-19-16-12(17(22)23)7-8-13(21(16)20-15)14-2-1-9-24-14/h1-9H,18H2,(H,22,23) |
| InChIKey | SMVJPJKDUZXGFS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|