C14H8F3N3O2 — CID 82566999
methyl 2-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate (PubChem CID 82566999) has the molecular formula C14H8F3N3O2 and a molecular weight of 307.23 g/mol. Its IUPAC name is methyl 2-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate.
| Compound Name | methyl 2-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 82566999 |
| Molecular Formula | C14H8F3N3O2 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | methyl 2-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate |
| SMILES | COC(=O)c1cccn2nc(-c3ccc(F)c(F)c3F)nc12 |
| InChI | InChI=1S/C14H8F3N3O2/c1-22-14(21)8-3-2-6-20-13(8)18-12(19-20)7-4-5-9(15)11(17)10(7)16/h2-6H,1H3 |
| InChIKey | CKWOOXIZXXZZTA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|