1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid

C9H11NO3 — CID 82600845

IUPAC1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid
SMILESCc1cc(C2(C(=O)O)CCC2)no1
InChIInChI=1S/C9H11NO3/c1-6-5-7(10-13-6)9(8(11)12)3-2-4-9/h5H,2-4H2,1H3,(H,11,12)
InChIKeyOXEDFHDRVQJULK-UHFFFAOYSA-N
MW181.19 g/mol
LogP1.49
Rot. Bonds2

About 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid

1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid (PubChem CID 82600845) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid
PubChem CID82600845
Molecular FormulaC9H11NO3
Molecular Weight181.19 g/mol
Exact Mass181.07
IUPAC Name1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid
SMILESCc1cc(C2(C(=O)O)CCC2)no1
InChIInChI=1S/C9H11NO3/c1-6-5-7(10-13-6)9(8(11)12)3-2-4-9/h5H,2-4H2,1H3,(H,11,12)
InChIKeyOXEDFHDRVQJULK-UHFFFAOYSA-N
XLogP1.49
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.19
LogP ≤ 51.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid?
The IUPAC name of 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid (CID 82600845) is 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid is Cc1cc(C2(C(=O)O)CCC2)no1.
What is the InChIKey of 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid?
The InChIKey is OXEDFHDRVQJULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-6-5-7(10-13-6)9(8(11)12)3-2-4-9/h5H,2-4H2,1H3,(H,11,12).
What are the key properties of 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid?
1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid has a molecular weight of 181.19 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-1,2-oxazol-3-yl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 82600845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).