2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid

C8H4ClN3O2 — CID 82612248

IUPAC2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(Cl)ncc2n1
InChIInChI=1S/C8H4ClN3O2/c9-8-10-3-6-4(12-8)1-2-5(11-6)7(13)14/h1-3H,(H,13,14)
InChIKeyQLLYOVSERZTART-UHFFFAOYSA-N
MW209.59 g/mol
LogP1.38
Rot. Bonds1

About 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid

2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid (PubChem CID 82612248) has the molecular formula C8H4ClN3O2 and a molecular weight of 209.59 g/mol. Its IUPAC name is 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid.

Molecular Properties

Compound Name2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid
PubChem CID82612248
Molecular FormulaC8H4ClN3O2
Molecular Weight209.59 g/mol
Exact Mass209.00
IUPAC Name2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(Cl)ncc2n1
InChIInChI=1S/C8H4ClN3O2/c9-8-10-3-6-4(12-8)1-2-5(11-6)7(13)14/h1-3H,(H,13,14)
InChIKeyQLLYOVSERZTART-UHFFFAOYSA-N
XLogP1.38
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.59
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid?
The IUPAC name of 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid (CID 82612248) is 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid.
What is the SMILES notation for 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid?
The canonical SMILES for 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid is O=C(O)c1ccc2nc(Cl)ncc2n1.
What is the InChIKey of 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid?
The InChIKey is QLLYOVSERZTART-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClN3O2/c9-8-10-3-6-4(12-8)1-2-5(11-6)7(13)14/h1-3H,(H,13,14).
What are the key properties of 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid?
2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid has a molecular weight of 209.59 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyrido[3,2-d]pyrimidine-6-carboxylic acid is sourced from PubChem (CID 82612248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).