1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid

C11H11NO3S — CID 82621200

IUPAC1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid
SMILESO=C(O)C1(c2cc3ncoc3s2)CCCC1
InChIInChI=1S/C11H11NO3S/c13-10(14)11(3-1-2-4-11)8-5-7-9(16-8)15-6-12-7/h5-6H,1-4H2,(H,13,14)
InChIKeyOYVOMDFNISSVFK-UHFFFAOYSA-N
MW237.28 g/mol
LogP2.79
Rot. Bonds2

About 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid

1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid (PubChem CID 82621200) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid
PubChem CID82621200
Molecular FormulaC11H11NO3S
Molecular Weight237.28 g/mol
Exact Mass237.05
IUPAC Name1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid
SMILESO=C(O)C1(c2cc3ncoc3s2)CCCC1
InChIInChI=1S/C11H11NO3S/c13-10(14)11(3-1-2-4-11)8-5-7-9(16-8)15-6-12-7/h5-6H,1-4H2,(H,13,14)
InChIKeyOYVOMDFNISSVFK-UHFFFAOYSA-N
XLogP2.79
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.28
LogP ≤ 52.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid?
The IUPAC name of 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid (CID 82621200) is 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid?
The canonical SMILES for 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid is O=C(O)C1(c2cc3ncoc3s2)CCCC1.
What is the InChIKey of 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid?
The InChIKey is OYVOMDFNISSVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c13-10(14)11(3-1-2-4-11)8-5-7-9(16-8)15-6-12-7/h5-6H,1-4H2,(H,13,14).
What are the key properties of 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid?
1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid has a molecular weight of 237.28 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thieno[3,2-d][1,3]oxazol-5-ylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 82621200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).