C13H14ClNO3 — CID 82625270
5-chloro-6-methoxyspiro[2,4-dihydro-1H-quinoline-3,1'-cyclopropane]-4-carboxylic acid (PubChem CID 82625270) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 5-chloro-6-methoxyspiro[2,4-dihydro-1H-quinoline-3,1'-cyclopropane]-4-carboxylic acid.
| Compound Name | 5-chloro-6-methoxyspiro[2,4-dihydro-1H-quinoline-3,1'-cyclopropane]-4-carboxylic acid |
|---|---|
| PubChem CID | 82625270 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-chloro-6-methoxyspiro[2,4-dihydro-1H-quinoline-3,1'-cyclopropane]-4-carboxylic acid |
| SMILES | COc1ccc2c(c1Cl)C(C(=O)O)C1(CC1)CN2 |
| InChI | InChI=1S/C13H14ClNO3/c1-18-8-3-2-7-9(11(8)14)10(12(16)17)13(4-5-13)6-15-7/h2-3,10,15H,4-6H2,1H3,(H,16,17) |
| InChIKey | XRDFRLNQTPEVSR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|