About 3,3-diethoxypyrrolidine
3,3-diethoxypyrrolidine (PubChem CID 82652167) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 3,3-diethoxypyrrolidine.
Molecular Properties
| Compound Name | 3,3-diethoxypyrrolidine |
| PubChem CID | 82652167 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 3,3-diethoxypyrrolidine |
| SMILES | CCOC1(OCC)CCNC1 |
| InChI | InChI=1S/C8H17NO2/c1-3-10-8(11-4-2)5-6-9-7-8/h9H,3-7H2,1-2H3 |
| InChIKey | CVOUDLKGSOTRPB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethoxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethoxypyrrolidine?
The IUPAC name of 3,3-diethoxypyrrolidine (CID 82652167) is 3,3-diethoxypyrrolidine.
What is the SMILES notation for 3,3-diethoxypyrrolidine?
The canonical SMILES for 3,3-diethoxypyrrolidine is CCOC1(OCC)CCNC1.
What is the InChIKey of 3,3-diethoxypyrrolidine?
The InChIKey is CVOUDLKGSOTRPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-3-10-8(11-4-2)5-6-9-7-8/h9H,3-7H2,1-2H3.
What are the key properties of 3,3-diethoxypyrrolidine?
3,3-diethoxypyrrolidine has a molecular weight of 159.23 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethoxypyrrolidine is sourced from PubChem (CID 82652167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).