C8H17NO2 — CID 82652167
3,3-diethoxypyrrolidine (PubChem CID 82652167) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 3,3-diethoxypyrrolidine.
| Compound Name | 3,3-diethoxypyrrolidine |
|---|---|
| PubChem CID | 82652167 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 3,3-diethoxypyrrolidine |
| SMILES | CCOC1(OCC)CCNC1 |
| InChI | InChI=1S/C8H17NO2/c1-3-10-8(11-4-2)5-6-9-7-8/h9H,3-7H2,1-2H3 |
| InChIKey | CVOUDLKGSOTRPB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|