C10H19NO2 — CID 82655471
3,3-dimethyl-2,4-dioxa-9-azaspiro[5.5]undecane (PubChem CID 82655471) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 3,3-dimethyl-2,4-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 82655471 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 3,3-dimethyl-2,4-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CC1(C)OCC2(CCNCC2)CO1 |
| InChI | InChI=1S/C10H19NO2/c1-9(2)12-7-10(8-13-9)3-5-11-6-4-10/h11H,3-8H2,1-2H3 |
| InChIKey | LRHOCWVFJMXXDT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |