C9H14N4O2S — CID 82664279
2-piperidin-3-yl-5,6-dihydro-[1,3]thiazolo[3,2-b][1,2,4]triazole 4,4-dioxide (PubChem CID 82664279) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-piperidin-3-yl-5,6-dihydro-[1,3]thiazolo[3,2-b][1,2,4]triazole 4,4-dioxide.
| Compound Name | 2-piperidin-3-yl-5,6-dihydro-[1,3]thiazolo[3,2-b][1,2,4]triazole 4,4-dioxide |
|---|---|
| PubChem CID | 82664279 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-piperidin-3-yl-5,6-dihydro-[1,3]thiazolo[3,2-b][1,2,4]triazole 4,4-dioxide |
| SMILES | O=S1(=O)CCn2nc(C3CCCNC3)nc21 |
| InChI | InChI=1S/C9H14N4O2S/c14-16(15)5-4-13-9(16)11-8(12-13)7-2-1-3-10-6-7/h7,10H,1-6H2 |
| InChIKey | NPGONWYOKKDYLJ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |