About 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane
3-(1,4-dimethylindol-2-yl)-1,4-oxazepane (PubChem CID 82664754) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane.
Molecular Properties
| Compound Name | 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane |
| PubChem CID | 82664754 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane |
| SMILES | Cc1cccc2c1cc(C1COCCCN1)n2C |
| InChI | InChI=1S/C15H20N2O/c1-11-5-3-6-14-12(11)9-15(17(14)2)13-10-18-8-4-7-16-13/h3,5-6,9,13,16H,4,7-8,10H2,1-2H3 |
| InChIKey | WCLDGSFZAUZPPN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane?
The IUPAC name of 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane (CID 82664754) is 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane.
What is the SMILES notation for 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane?
The canonical SMILES for 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane is Cc1cccc2c1cc(C1COCCCN1)n2C.
What is the InChIKey of 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane?
The InChIKey is WCLDGSFZAUZPPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O/c1-11-5-3-6-14-12(11)9-15(17(14)2)13-10-18-8-4-7-16-13/h3,5-6,9,13,16H,4,7-8,10H2,1-2H3.
What are the key properties of 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane?
3-(1,4-dimethylindol-2-yl)-1,4-oxazepane has a molecular weight of 244.34 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dimethylindol-2-yl)-1,4-oxazepane is sourced from PubChem (CID 82664754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).