C12H16N4O2 — CID 82665137
2-(2-methoxy-5-methylpyrrolo[3,2-d]pyrimidin-7-yl)morpholine (PubChem CID 82665137) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-(2-methoxy-5-methylpyrrolo[3,2-d]pyrimidin-7-yl)morpholine.
| Compound Name | 2-(2-methoxy-5-methylpyrrolo[3,2-d]pyrimidin-7-yl)morpholine |
|---|---|
| PubChem CID | 82665137 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-(2-methoxy-5-methylpyrrolo[3,2-d]pyrimidin-7-yl)morpholine |
| SMILES | COc1ncc2c(n1)c(C1CNCCO1)cn2C |
| InChI | InChI=1S/C12H16N4O2/c1-16-7-8(10-6-13-3-4-18-10)11-9(16)5-14-12(15-11)17-2/h5,7,10,13H,3-4,6H2,1-2H3 |
| InChIKey | XOPVNLNSSUHVBI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |