C14H22ClF3N2O — CID 82699338
4-(1-chloroethyl)-3,5-diethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole (PubChem CID 82699338) has the molecular formula C14H22ClF3N2O and a molecular weight of 326.79 g/mol. Its IUPAC name is 4-(1-chloroethyl)-3,5-diethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole.
| Compound Name | 4-(1-chloroethyl)-3,5-diethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole |
|---|---|
| PubChem CID | 82699338 |
| Molecular Formula | C14H22ClF3N2O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-(1-chloroethyl)-3,5-diethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole |
| SMILES | CCc1nn(CCCOCC(F)(F)F)c(CC)c1C(C)Cl |
| InChI | InChI=1S/C14H22ClF3N2O/c1-4-11-13(10(3)15)12(5-2)20(19-11)7-6-8-21-9-14(16,17)18/h10H,4-9H2,1-3H3 |
| InChIKey | CDLZRAVAINAHIK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|