C12H17Br2NO — CID 82720321
1-(2,4-dibromophenyl)-N-[(2-methylpropan-2-yl)oxy]ethanamine (PubChem CID 82720321) has the molecular formula C12H17Br2NO and a molecular weight of 351.08 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-N-[(2-methylpropan-2-yl)oxy]ethanamine.
| Compound Name | 1-(2,4-dibromophenyl)-N-[(2-methylpropan-2-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 82720321 |
| Molecular Formula | C12H17Br2NO |
| Molecular Weight | 351.08 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 1-(2,4-dibromophenyl)-N-[(2-methylpropan-2-yl)oxy]ethanamine |
| SMILES | CC(NOC(C)(C)C)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H17Br2NO/c1-8(15-16-12(2,3)4)10-6-5-9(13)7-11(10)14/h5-8,15H,1-4H3 |
| InChIKey | ZQLLMKXNTADJMO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.08 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|