C8H11NO3 — CID 82758942
4-[(1R)-1-hydroxyethyl]-1-methylpyrrole-2-carboxylic acid (PubChem CID 82758942) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-[(1R)-1-hydroxyethyl]-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-[(1R)-1-hydroxyethyl]-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 82758942 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-[(1R)-1-hydroxyethyl]-1-methylpyrrole-2-carboxylic acid |
| SMILES | C[C@@H](O)c1cc(C(=O)O)n(C)c1 |
| InChI | InChI=1S/C8H11NO3/c1-5(10)6-3-7(8(11)12)9(2)4-6/h3-5,10H,1-2H3,(H,11,12)/t5-/m1/s1 |
| InChIKey | LZGVOTOJPIKVPA-RXMQYKEDSA-N |
| XLogP | 0.78 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |