C16H26F3NO — CID 82782797
1-(1-adamantyl)-2-(4,4,4-trifluorobutoxy)ethanamine (PubChem CID 82782797) has the molecular formula C16H26F3NO and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-(4,4,4-trifluorobutoxy)ethanamine.
| Compound Name | 1-(1-adamantyl)-2-(4,4,4-trifluorobutoxy)ethanamine |
|---|---|
| PubChem CID | 82782797 |
| Molecular Formula | C16H26F3NO |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 1-(1-adamantyl)-2-(4,4,4-trifluorobutoxy)ethanamine |
| SMILES | NC(COCCCC(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H26F3NO/c17-16(18,19)2-1-3-21-10-14(20)15-7-11-4-12(8-15)6-13(5-11)9-15/h11-14H,1-10,20H2 |
| InChIKey | QHSDNRUZCMISIE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|