C15H24F3NO — CID 82954065
1-(1-adamantyl)-2-(3,3,3-trifluoropropoxy)ethanamine (PubChem CID 82954065) has the molecular formula C15H24F3NO and a molecular weight of 291.36 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-(3,3,3-trifluoropropoxy)ethanamine.
| Compound Name | 1-(1-adamantyl)-2-(3,3,3-trifluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 82954065 |
| Molecular Formula | C15H24F3NO |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-(1-adamantyl)-2-(3,3,3-trifluoropropoxy)ethanamine |
| SMILES | NC(COCCC(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H24F3NO/c16-15(17,18)1-2-20-9-13(19)14-6-10-3-11(7-14)5-12(4-10)8-14/h10-13H,1-9,19H2 |
| InChIKey | GLPSUKBEMHARBU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|