C16H15BrN2OS — CID 82786498
3-bromo-4-(3,4-dihydro-2H-chromen-4-ylamino)benzenecarbothioamide (PubChem CID 82786498) has the molecular formula C16H15BrN2OS and a molecular weight of 363.28 g/mol. Its IUPAC name is 3-bromo-4-(3,4-dihydro-2H-chromen-4-ylamino)benzenecarbothioamide.
| Compound Name | 3-bromo-4-(3,4-dihydro-2H-chromen-4-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 82786498 |
| Molecular Formula | C16H15BrN2OS |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 3-bromo-4-(3,4-dihydro-2H-chromen-4-ylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NC2CCOc3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C16H15BrN2OS/c17-12-9-10(16(18)21)5-6-14(12)19-13-7-8-20-15-4-2-1-3-11(13)15/h1-6,9,13,19H,7-8H2,(H2,18,21) |
| InChIKey | XHKIWALCBRDHEA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|