About 4-azido-3-bromobenzamide
4-azido-3-bromobenzamide (PubChem CID 82802325) has the molecular formula C7H5BrN4O
and a molecular weight of 241.05 g/mol. Its IUPAC name is 4-azido-3-bromobenzamide.
Molecular Properties
| Compound Name | 4-azido-3-bromobenzamide |
| PubChem CID | 82802325 |
| Molecular Formula | C7H5BrN4O |
| Molecular Weight | 241.05 g/mol |
| Exact Mass | 239.96 |
| IUPAC Name | 4-azido-3-bromobenzamide |
| SMILES | [N-]=[N+]=Nc1ccc(C(N)=O)cc1Br |
| InChI | InChI=1S/C7H5BrN4O/c8-5-3-4(7(9)13)1-2-6(5)11-12-10/h1-3H,(H2,9,13) |
| InChIKey | TURXVLJNYPCWOM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.05 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-3-bromobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-3-bromobenzamide?
The IUPAC name of 4-azido-3-bromobenzamide (CID 82802325) is 4-azido-3-bromobenzamide.
What is the SMILES notation for 4-azido-3-bromobenzamide?
The canonical SMILES for 4-azido-3-bromobenzamide is [N-]=[N+]=Nc1ccc(C(N)=O)cc1Br.
What is the InChIKey of 4-azido-3-bromobenzamide?
The InChIKey is TURXVLJNYPCWOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN4O/c8-5-3-4(7(9)13)1-2-6(5)11-12-10/h1-3H,(H2,9,13).
What are the key properties of 4-azido-3-bromobenzamide?
4-azido-3-bromobenzamide has a molecular weight of 241.05 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-3-bromobenzamide is sourced from PubChem (CID 82802325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).