C22H24N2O2 — CID 828114
3-[2-[(4-methoxyphenyl)methylideneamino]anilino]-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 828114) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-[2-[(4-methoxyphenyl)methylideneamino]anilino]-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 3-[2-[(4-methoxyphenyl)methylideneamino]anilino]-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 828114 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 3-[2-[(4-methoxyphenyl)methylideneamino]anilino]-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | COc1ccc(/C=N\c2ccccc2NC2=CC(=O)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-22(2)13-17(12-18(25)14-22)24-21-7-5-4-6-20(21)23-15-16-8-10-19(26-3)11-9-16/h4-12,15,24H,13-14H2,1-3H3/b23-15- |
| InChIKey | ZUKQUTBTLYENAM-HAHDFKILSA-N |
| XLogP | 5.13 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|