C30H34N4O4 — CID 135034164
N,N'-bis[2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]oxamide (PubChem CID 135034164) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is N,N'-bis[2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]oxamide.
| Compound Name | N,N'-bis[2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]oxamide |
|---|---|
| PubChem CID | 135034164 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | N,N'-bis[2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]oxamide |
| SMILES | CC1(C)CC(=O)C=C(Nc2ccccc2NC(=O)C(=O)Nc2ccccc2NC2=CC(=O)CC(C)(C)C2)C1 |
| InChI | InChI=1S/C30H34N4O4/c1-29(2)15-19(13-21(35)17-29)31-23-9-5-7-11-25(23)33-27(37)28(38)34-26-12-8-6-10-24(26)32-20-14-22(36)18-30(3,4)16-20/h5-14,31-32H,15-18H2,1-4H3,(H,33,37)(H,34,38) |
| InChIKey | DXWCFDLLTNBQBS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|