C12H17F2N — CID 82814305
N-[(2,6-difluoro-3-methylphenyl)methyl]butan-2-amine (PubChem CID 82814305) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is N-[(2,6-difluoro-3-methylphenyl)methyl]butan-2-amine.
| Compound Name | N-[(2,6-difluoro-3-methylphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 82814305 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[(2,6-difluoro-3-methylphenyl)methyl]butan-2-amine |
| SMILES | CCC(C)NCc1c(F)ccc(C)c1F |
| InChI | InChI=1S/C12H17F2N/c1-4-9(3)15-7-10-11(13)6-5-8(2)12(10)14/h5-6,9,15H,4,7H2,1-3H3 |
| InChIKey | STWXPZLWAMAMDU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |