C17H18BrN — CID 82821533
N-(2-bromophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine (PubChem CID 82821533) has the molecular formula C17H18BrN and a molecular weight of 316.24 g/mol. Its IUPAC name is N-(2-bromophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine.
| Compound Name | N-(2-bromophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 82821533 |
| Molecular Formula | C17H18BrN |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-(2-bromophenyl)-2,2-dimethyl-1,3-dihydroinden-1-amine |
| SMILES | CC1(C)Cc2ccccc2C1Nc1ccccc1Br |
| InChI | InChI=1S/C17H18BrN/c1-17(2)11-12-7-3-4-8-13(12)16(17)19-15-10-6-5-9-14(15)18/h3-10,16,19H,11H2,1-2H3 |
| InChIKey | QPTILEBAEDEOKS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |